About imidazo[1,2-a]quinolin-7-ylmethanol
imidazo[1,2-a]quinolin-7-ylmethanol (PubChem CID 115021375) has the molecular formula C12H10N2O
and a molecular weight of 198.22 g/mol. Its IUPAC name is imidazo[1,2-a]quinolin-7-ylmethanol.
Molecular Properties
| Compound Name | imidazo[1,2-a]quinolin-7-ylmethanol |
| PubChem CID | 115021375 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | imidazo[1,2-a]quinolin-7-ylmethanol |
| SMILES | OCc1ccc2c(ccc3nccn32)c1 |
| InChI | InChI=1S/C12H10N2O/c15-8-9-1-3-11-10(7-9)2-4-12-13-5-6-14(11)12/h1-7,15H,8H2 |
| InChIKey | VYQCFNCFPSYDHE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze imidazo[1,2-a]quinolin-7-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,2-a]quinolin-7-ylmethanol?
The IUPAC name of imidazo[1,2-a]quinolin-7-ylmethanol (CID 115021375) is imidazo[1,2-a]quinolin-7-ylmethanol.
What is the SMILES notation for imidazo[1,2-a]quinolin-7-ylmethanol?
The canonical SMILES for imidazo[1,2-a]quinolin-7-ylmethanol is OCc1ccc2c(ccc3nccn32)c1.
What is the InChIKey of imidazo[1,2-a]quinolin-7-ylmethanol?
The InChIKey is VYQCFNCFPSYDHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O/c15-8-9-1-3-11-10(7-9)2-4-12-13-5-6-14(11)12/h1-7,15H,8H2.
What are the key properties of imidazo[1,2-a]quinolin-7-ylmethanol?
imidazo[1,2-a]quinolin-7-ylmethanol has a molecular weight of 198.22 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,2-a]quinolin-7-ylmethanol is sourced from PubChem (CID 115021375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).