About [5-(thian-4-yl)-1,3-oxazol-2-yl]methanol
[5-(thian-4-yl)-1,3-oxazol-2-yl]methanol (PubChem CID 115021753) has the molecular formula C9H13NO2S
and a molecular weight of 199.27 g/mol. Its IUPAC name is [5-(thian-4-yl)-1,3-oxazol-2-yl]methanol.
Molecular Properties
| Compound Name | [5-(thian-4-yl)-1,3-oxazol-2-yl]methanol |
| PubChem CID | 115021753 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | [5-(thian-4-yl)-1,3-oxazol-2-yl]methanol |
| SMILES | OCc1ncc(C2CCSCC2)o1 |
| InChI | InChI=1S/C9H13NO2S/c11-6-9-10-5-8(12-9)7-1-3-13-4-2-7/h5,7,11H,1-4,6H2 |
| InChIKey | ZWMSELVSQONSCC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(thian-4-yl)-1,3-oxazol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(thian-4-yl)-1,3-oxazol-2-yl]methanol?
The IUPAC name of [5-(thian-4-yl)-1,3-oxazol-2-yl]methanol (CID 115021753) is [5-(thian-4-yl)-1,3-oxazol-2-yl]methanol.
What is the SMILES notation for [5-(thian-4-yl)-1,3-oxazol-2-yl]methanol?
The canonical SMILES for [5-(thian-4-yl)-1,3-oxazol-2-yl]methanol is OCc1ncc(C2CCSCC2)o1.
What is the InChIKey of [5-(thian-4-yl)-1,3-oxazol-2-yl]methanol?
The InChIKey is ZWMSELVSQONSCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S/c11-6-9-10-5-8(12-9)7-1-3-13-4-2-7/h5,7,11H,1-4,6H2.
What are the key properties of [5-(thian-4-yl)-1,3-oxazol-2-yl]methanol?
[5-(thian-4-yl)-1,3-oxazol-2-yl]methanol has a molecular weight of 199.27 g/mol, XLogP of 1.78, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(thian-4-yl)-1,3-oxazol-2-yl]methanol is sourced from PubChem (CID 115021753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).