About methyl 2-[4-(1-aminoethyl)-1,3-thiazol-2-yl]acetate
methyl 2-[4-(1-aminoethyl)-1,3-thiazol-2-yl]acetate (PubChem CID 115021994) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is methyl 2-[4-(1-aminoethyl)-1,3-thiazol-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[4-(1-aminoethyl)-1,3-thiazol-2-yl]acetate |
| PubChem CID | 115021994 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | methyl 2-[4-(1-aminoethyl)-1,3-thiazol-2-yl]acetate |
| SMILES | COC(=O)Cc1nc(C(C)N)cs1 |
| InChI | InChI=1S/C8H12N2O2S/c1-5(9)6-4-13-7(10-6)3-8(11)12-2/h4-5H,3,9H2,1-2H3 |
| InChIKey | UWXRQZMIZKRGQU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[4-(1-aminoethyl)-1,3-thiazol-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-(1-aminoethyl)-1,3-thiazol-2-yl]acetate?
The IUPAC name of methyl 2-[4-(1-aminoethyl)-1,3-thiazol-2-yl]acetate (CID 115021994) is methyl 2-[4-(1-aminoethyl)-1,3-thiazol-2-yl]acetate.
What is the SMILES notation for methyl 2-[4-(1-aminoethyl)-1,3-thiazol-2-yl]acetate?
The canonical SMILES for methyl 2-[4-(1-aminoethyl)-1,3-thiazol-2-yl]acetate is COC(=O)Cc1nc(C(C)N)cs1.
What is the InChIKey of methyl 2-[4-(1-aminoethyl)-1,3-thiazol-2-yl]acetate?
The InChIKey is UWXRQZMIZKRGQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c1-5(9)6-4-13-7(10-6)3-8(11)12-2/h4-5H,3,9H2,1-2H3.
What are the key properties of methyl 2-[4-(1-aminoethyl)-1,3-thiazol-2-yl]acetate?
methyl 2-[4-(1-aminoethyl)-1,3-thiazol-2-yl]acetate has a molecular weight of 200.26 g/mol, XLogP of 0.88, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-(1-aminoethyl)-1,3-thiazol-2-yl]acetate is sourced from PubChem (CID 115021994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).