About [(3S)-1-azabicyclo[2.2.2]octan-3-yl] 6-(trifluoromethoxy)-1H-indazole-3-carboxylate;formic acid
[(3S)-1-azabicyclo[2.2.2]octan-3-yl] 6-(trifluoromethoxy)-1H-indazole-3-carboxylate;formic acid (PubChem CID 11502227) has the molecular formula C17H18F3N3O5
and a molecular weight of 401.34 g/mol. Its IUPAC name is [(3S)-1-azabicyclo[2.2.2]octan-3-yl] 6-(trifluoromethoxy)-1H-indazole-3-carboxylate;formic acid.
Molecular Properties
| Compound Name | [(3S)-1-azabicyclo[2.2.2]octan-3-yl] 6-(trifluoromethoxy)-1H-indazole-3-carboxylate;formic acid |
| PubChem CID | 11502227 |
| Molecular Formula | C17H18F3N3O5 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | [(3S)-1-azabicyclo[2.2.2]octan-3-yl] 6-(trifluoromethoxy)-1H-indazole-3-carboxylate;formic acid |
| SMILES | O=C(O[C@@H]1CN2CCC1CC2)c1n[nH]c2cc(OC(F)(F)F)ccc12.O=CO |
| InChI | InChI=1S/C16H16F3N3O3.CH2O2/c17-16(18,19)25-10-1-2-11-12(7-10)20-21-14(11)15(23)24-13-8-22-5-3-9(13)4-6-22;2-1-3/h1-2,7,9,13H,3-6,8H2,(H,20,21);1H,(H,2,3)/t13-;/m1./s1 |
| InChIKey | SWOMUULJKFPCIM-BTQNPOSSSA-N |
| XLogP | 2.41 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-1-azabicyclo[2.2.2]octan-3-yl] 6-(trifluoromethoxy)-1H-indazole-3-carboxylate;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-1-azabicyclo[2.2.2]octan-3-yl] 6-(trifluoromethoxy)-1H-indazole-3-carboxylate;formic acid?
The IUPAC name of [(3S)-1-azabicyclo[2.2.2]octan-3-yl] 6-(trifluoromethoxy)-1H-indazole-3-carboxylate;formic acid (CID 11502227) is [(3S)-1-azabicyclo[2.2.2]octan-3-yl] 6-(trifluoromethoxy)-1H-indazole-3-carboxylate;formic acid.
What is the SMILES notation for [(3S)-1-azabicyclo[2.2.2]octan-3-yl] 6-(trifluoromethoxy)-1H-indazole-3-carboxylate;formic acid?
The canonical SMILES for [(3S)-1-azabicyclo[2.2.2]octan-3-yl] 6-(trifluoromethoxy)-1H-indazole-3-carboxylate;formic acid is O=C(O[C@@H]1CN2CCC1CC2)c1n[nH]c2cc(OC(F)(F)F)ccc12.O=CO.
What is the InChIKey of [(3S)-1-azabicyclo[2.2.2]octan-3-yl] 6-(trifluoromethoxy)-1H-indazole-3-carboxylate;formic acid?
The InChIKey is SWOMUULJKFPCIM-BTQNPOSSSA-N. The full InChI is InChI=1S/C16H16F3N3O3.CH2O2/c17-16(18,19)25-10-1-2-11-12(7-10)20-21-14(11)15(23)24-13-8-22-5-3-9(13)4-6-22;2-1-3/h1-2,7,9,13H,3-6,8H2,(H,20,21);1H,(H,2,3)/t13-;/m1./s1.
What are the key properties of [(3S)-1-azabicyclo[2.2.2]octan-3-yl] 6-(trifluoromethoxy)-1H-indazole-3-carboxylate;formic acid?
[(3S)-1-azabicyclo[2.2.2]octan-3-yl] 6-(trifluoromethoxy)-1H-indazole-3-carboxylate;formic acid has a molecular weight of 401.34 g/mol, XLogP of 2.41, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-1-azabicyclo[2.2.2]octan-3-yl] 6-(trifluoromethoxy)-1H-indazole-3-carboxylate;formic acid is sourced from PubChem (CID 11502227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).