C9H12ClNO2 — CID 115022436
2-chloro-5-ethyl-4-(oxolan-2-yl)-1,3-oxazole (PubChem CID 115022436) has the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. Its IUPAC name is 2-chloro-5-ethyl-4-(oxolan-2-yl)-1,3-oxazole.
| Compound Name | 2-chloro-5-ethyl-4-(oxolan-2-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 115022436 |
| Molecular Formula | C9H12ClNO2 |
| Molecular Weight | 201.65 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2-chloro-5-ethyl-4-(oxolan-2-yl)-1,3-oxazole |
| SMILES | CCc1oc(Cl)nc1C1CCCO1 |
| InChI | InChI=1S/C9H12ClNO2/c1-2-6-8(11-9(10)13-6)7-4-3-5-12-7/h7H,2-5H2,1H3 |
| InChIKey | CVQKQTFJIQFPPV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.65 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |