C23H30O6 — CID 11502260
(1R,2R,3S,4R,5R)-1-[3-[(4-ethylphenyl)methyl]-4-methoxyphenyl]-5-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol (PubChem CID 11502260) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is (1R,2R,3S,4R,5R)-1-[3-[(4-ethylphenyl)methyl]-4-methoxyphenyl]-5-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol.
| Compound Name | (1R,2R,3S,4R,5R)-1-[3-[(4-ethylphenyl)methyl]-4-methoxyphenyl]-5-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 11502260 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (1R,2R,3S,4R,5R)-1-[3-[(4-ethylphenyl)methyl]-4-methoxyphenyl]-5-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol |
| SMILES | CCc1ccc(Cc2cc([C@]3(O)C[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2OC)cc1 |
| InChI | InChI=1S/C23H30O6/c1-3-14-4-6-15(7-5-14)10-16-11-18(8-9-19(16)29-2)23(28)12-17(13-24)20(25)21(26)22(23)27/h4-9,11,17,20-22,24-28H,3,10,12-13H2,1-2H3/t17-,20-,21+,22-,23-/m1/s1 |
| InChIKey | ADAINMOCVZQXHL-LDBVRRDLSA-N |
| XLogP | 1.13 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |