About [(1S,2R)-2-[(1S)-1-diphenylphosphanyl-2-methylpropyl]cyclopentyl] methanesulfonate
[(1S,2R)-2-[(1S)-1-diphenylphosphanyl-2-methylpropyl]cyclopentyl] methanesulfonate (PubChem CID 11502314) has the molecular formula C22H29O3PS
and a molecular weight of 404.51 g/mol. Its IUPAC name is [(1S,2R)-2-[(1S)-1-diphenylphosphanyl-2-methylpropyl]cyclopentyl] methanesulfonate.
Molecular Properties
| Compound Name | [(1S,2R)-2-[(1S)-1-diphenylphosphanyl-2-methylpropyl]cyclopentyl] methanesulfonate |
| PubChem CID | 11502314 |
| Molecular Formula | C22H29O3PS |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | [(1S,2R)-2-[(1S)-1-diphenylphosphanyl-2-methylpropyl]cyclopentyl] methanesulfonate |
| SMILES | CC(C)[C@@H]([C@@H]1CCC[C@@H]1OS(C)(=O)=O)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29O3PS/c1-17(2)22(20-15-10-16-21(20)25-27(3,23)24)26(18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-9,11-14,17,20-22H,10,15-16H2,1-3H3/t20-,21+,22+/m1/s1 |
| InChIKey | CFOBLHDEXHJZPY-FSSWDIPSSA-N |
| XLogP | 4.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2R)-2-[(1S)-1-diphenylphosphanyl-2-methylpropyl]cyclopentyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-[(1S)-1-diphenylphosphanyl-2-methylpropyl]cyclopentyl] methanesulfonate?
The IUPAC name of [(1S,2R)-2-[(1S)-1-diphenylphosphanyl-2-methylpropyl]cyclopentyl] methanesulfonate (CID 11502314) is [(1S,2R)-2-[(1S)-1-diphenylphosphanyl-2-methylpropyl]cyclopentyl] methanesulfonate.
What is the SMILES notation for [(1S,2R)-2-[(1S)-1-diphenylphosphanyl-2-methylpropyl]cyclopentyl] methanesulfonate?
The canonical SMILES for [(1S,2R)-2-[(1S)-1-diphenylphosphanyl-2-methylpropyl]cyclopentyl] methanesulfonate is CC(C)[C@@H]([C@@H]1CCC[C@@H]1OS(C)(=O)=O)P(c1ccccc1)c1ccccc1.
What is the InChIKey of [(1S,2R)-2-[(1S)-1-diphenylphosphanyl-2-methylpropyl]cyclopentyl] methanesulfonate?
The InChIKey is CFOBLHDEXHJZPY-FSSWDIPSSA-N. The full InChI is InChI=1S/C22H29O3PS/c1-17(2)22(20-15-10-16-21(20)25-27(3,23)24)26(18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-9,11-14,17,20-22H,10,15-16H2,1-3H3/t20-,21+,22+/m1/s1.
What are the key properties of [(1S,2R)-2-[(1S)-1-diphenylphosphanyl-2-methylpropyl]cyclopentyl] methanesulfonate?
[(1S,2R)-2-[(1S)-1-diphenylphosphanyl-2-methylpropyl]cyclopentyl] methanesulfonate has a molecular weight of 404.51 g/mol, XLogP of 4.29, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-[(1S)-1-diphenylphosphanyl-2-methylpropyl]cyclopentyl] methanesulfonate is sourced from PubChem (CID 11502314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).