About 1,5-dimethyl-3,4-dihydro-2H-quinoline-2-carboxylic acid
1,5-dimethyl-3,4-dihydro-2H-quinoline-2-carboxylic acid (PubChem CID 115024025) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 1,5-dimethyl-3,4-dihydro-2H-quinoline-2-carboxylic acid.
Molecular Properties
| Compound Name | 1,5-dimethyl-3,4-dihydro-2H-quinoline-2-carboxylic acid |
| PubChem CID | 115024025 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 1,5-dimethyl-3,4-dihydro-2H-quinoline-2-carboxylic acid |
| SMILES | Cc1cccc2c1CCC(C(=O)O)N2C |
| InChI | InChI=1S/C12H15NO2/c1-8-4-3-5-10-9(8)6-7-11(12(14)15)13(10)2/h3-5,11H,6-7H2,1-2H3,(H,14,15) |
| InChIKey | ICSZJTLANBEDMR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,5-dimethyl-3,4-dihydro-2H-quinoline-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-3,4-dihydro-2H-quinoline-2-carboxylic acid?
The IUPAC name of 1,5-dimethyl-3,4-dihydro-2H-quinoline-2-carboxylic acid (CID 115024025) is 1,5-dimethyl-3,4-dihydro-2H-quinoline-2-carboxylic acid.
What is the SMILES notation for 1,5-dimethyl-3,4-dihydro-2H-quinoline-2-carboxylic acid?
The canonical SMILES for 1,5-dimethyl-3,4-dihydro-2H-quinoline-2-carboxylic acid is Cc1cccc2c1CCC(C(=O)O)N2C.
What is the InChIKey of 1,5-dimethyl-3,4-dihydro-2H-quinoline-2-carboxylic acid?
The InChIKey is ICSZJTLANBEDMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-8-4-3-5-10-9(8)6-7-11(12(14)15)13(10)2/h3-5,11H,6-7H2,1-2H3,(H,14,15).
What are the key properties of 1,5-dimethyl-3,4-dihydro-2H-quinoline-2-carboxylic acid?
1,5-dimethyl-3,4-dihydro-2H-quinoline-2-carboxylic acid has a molecular weight of 205.26 g/mol, XLogP of 1.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-3,4-dihydro-2H-quinoline-2-carboxylic acid is sourced from PubChem (CID 115024025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).