C17H14F3N5O2S — CID 11502414
(5Z)-5-[[4-[4-(trifluoromethyl)piperidin-1-yl]pyrido[3,2-d]pyrimidin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 11502414) has the molecular formula C17H14F3N5O2S and a molecular weight of 409.39 g/mol. Its IUPAC name is (5Z)-5-[[4-[4-(trifluoromethyl)piperidin-1-yl]pyrido[3,2-d]pyrimidin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[4-(trifluoromethyl)piperidin-1-yl]pyrido[3,2-d]pyrimidin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 11502414 |
| Molecular Formula | C17H14F3N5O2S |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | (5Z)-5-[[4-[4-(trifluoromethyl)piperidin-1-yl]pyrido[3,2-d]pyrimidin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc3ncnc(N4CCC(C(F)(F)F)CC4)c3n2)S1 |
| InChI | InChI=1S/C17H14F3N5O2S/c18-17(19,20)9-3-5-25(6-4-9)14-13-11(21-8-22-14)2-1-10(23-13)7-12-15(26)24-16(27)28-12/h1-2,7-9H,3-6H2,(H,24,26,27)/b12-7- |
| InChIKey | SHJWCNWPFZYSSY-GHXNOFRVSA-N |
| XLogP | 3.13 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|