C22H19ClN2O4 — CID 11502448
ethyl (1S,8S,9S)-10-[(5-chloro-1H-indole-2-carbonyl)amino]-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9-carboxylate (PubChem CID 11502448) has the molecular formula C22H19ClN2O4 and a molecular weight of 410.86 g/mol. Its IUPAC name is ethyl (1S,8S,9S)-10-[(5-chloro-1H-indole-2-carbonyl)amino]-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9-carboxylate.
| Compound Name | ethyl (1S,8S,9S)-10-[(5-chloro-1H-indole-2-carbonyl)amino]-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9-carboxylate |
|---|---|
| PubChem CID | 11502448 |
| Molecular Formula | C22H19ClN2O4 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | ethyl (1S,8S,9S)-10-[(5-chloro-1H-indole-2-carbonyl)amino]-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(NC(=O)c2cc3cc(Cl)ccc3[nH]2)[C@H]2O[C@@H]1c1ccccc12 |
| InChI | InChI=1S/C22H19ClN2O4/c1-2-28-22(27)17-18(20-14-6-4-3-5-13(14)19(17)29-20)25-21(26)16-10-11-9-12(23)7-8-15(11)24-16/h3-10,17-20,24H,2H2,1H3,(H,25,26)/t17-,18?,19+,20-/m0/s1 |
| InChIKey | MJBWYAWAOVRMKW-XGKJMYGNSA-N |
| XLogP | 3.93 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |