C20H38O5Si2 — CID 11502524
(1R,2S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxy-7-oxabicyclo[4.1.0]hept-3-ene-3-carbaldehyde (PubChem CID 11502524) has the molecular formula C20H38O5Si2 and a molecular weight of 414.69 g/mol. Its IUPAC name is (1R,2S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxy-7-oxabicyclo[4.1.0]hept-3-ene-3-carbaldehyde.
| Compound Name | (1R,2S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxy-7-oxabicyclo[4.1.0]hept-3-ene-3-carbaldehyde |
|---|---|
| PubChem CID | 11502524 |
| Molecular Formula | C20H38O5Si2 |
| Molecular Weight | 414.69 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (1R,2S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxy-7-oxabicyclo[4.1.0]hept-3-ene-3-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=C(C=O)[C@H](O)[C@H]2O[C@H]2[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O5Si2/c1-19(2,3)26(7,8)23-12-14-13(11-21)15(22)17-18(24-17)16(14)25-27(9,10)20(4,5)6/h11,15-18,22H,12H2,1-10H3/t15-,16+,17+,18-/m0/s1 |
| InChIKey | DNYBMVSKWDNUTI-MLHJIOFPSA-N |
| XLogP | 4.04 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.69 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|