About 2-(thiolan-3-yl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine
2-(thiolan-3-yl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine (PubChem CID 115025453) has the molecular formula C10H13N3S
and a molecular weight of 207.30 g/mol. Its IUPAC name is 2-(thiolan-3-yl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 2-(thiolan-3-yl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine |
| PubChem CID | 115025453 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 2-(thiolan-3-yl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine |
| SMILES | c1nc(C2CCSC2)nc2c1CNC2 |
| InChI | InChI=1S/C10H13N3S/c1-2-14-6-7(1)10-12-4-8-3-11-5-9(8)13-10/h4,7,11H,1-3,5-6H2 |
| InChIKey | MUENNUVBVFJOTF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(thiolan-3-yl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(thiolan-3-yl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
The IUPAC name of 2-(thiolan-3-yl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine (CID 115025453) is 2-(thiolan-3-yl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine.
What is the SMILES notation for 2-(thiolan-3-yl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
The canonical SMILES for 2-(thiolan-3-yl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine is c1nc(C2CCSC2)nc2c1CNC2.
What is the InChIKey of 2-(thiolan-3-yl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
The InChIKey is MUENNUVBVFJOTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3S/c1-2-14-6-7(1)10-12-4-8-3-11-5-9(8)13-10/h4,7,11H,1-3,5-6H2.
What are the key properties of 2-(thiolan-3-yl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
2-(thiolan-3-yl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine has a molecular weight of 207.30 g/mol, XLogP of 1.30, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(thiolan-3-yl)-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine is sourced from PubChem (CID 115025453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).