About 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine
7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine (PubChem CID 115025603) has the molecular formula C10H10ClN3
and a molecular weight of 207.66 g/mol. Its IUPAC name is 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine.
Molecular Properties
| Compound Name | 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine |
| PubChem CID | 115025603 |
| Molecular Formula | C10H10ClN3 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine |
| SMILES | NC1CCn2c1nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C10H10ClN3/c11-6-1-2-8-9(5-6)14-4-3-7(12)10(14)13-8/h1-2,5,7H,3-4,12H2 |
| InChIKey | HSHFWBVQFNKNEA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine?
The IUPAC name of 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine (CID 115025603) is 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine.
What is the SMILES notation for 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine?
The canonical SMILES for 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine is NC1CCn2c1nc1ccc(Cl)cc12.
What is the InChIKey of 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine?
The InChIKey is HSHFWBVQFNKNEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN3/c11-6-1-2-8-9(5-6)14-4-3-7(12)10(14)13-8/h1-2,5,7H,3-4,12H2.
What are the key properties of 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine?
7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine has a molecular weight of 207.66 g/mol, XLogP of 2.09, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-3-amine is sourced from PubChem (CID 115025603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).