C17H15N5O6S — CID 11502581
4-(dimethylamino)-N-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-3,5-dinitrobenzamide (PubChem CID 11502581) has the molecular formula C17H15N5O6S and a molecular weight of 417.40 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-3,5-dinitrobenzamide.
| Compound Name | 4-(dimethylamino)-N-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 11502581 |
| Molecular Formula | C17H15N5O6S |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 4-(dimethylamino)-N-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-3,5-dinitrobenzamide |
| SMILES | CN(C)c1c([N+](=O)[O-])cc(C(=O)Nc2ccc3sc(CO)nc3c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15N5O6S/c1-20(2)16-12(21(25)26)5-9(6-13(16)22(27)28)17(24)18-10-3-4-14-11(7-10)19-15(8-23)29-14/h3-7,23H,8H2,1-2H3,(H,18,24) |
| InChIKey | UJYOBWWZHUWHHB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 151.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|