About 4-(dimethylamino)-N-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-3,5-dinitrobenzamide
4-(dimethylamino)-N-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-3,5-dinitrobenzamide (PubChem CID 11502581) has the molecular formula C17H15N5O6S
and a molecular weight of 417.40 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-3,5-dinitrobenzamide.
Molecular Properties
| Compound Name | 4-(dimethylamino)-N-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-3,5-dinitrobenzamide |
| PubChem CID | 11502581 |
| Molecular Formula | C17H15N5O6S |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 4-(dimethylamino)-N-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-3,5-dinitrobenzamide |
| SMILES | CN(C)c1c([N+](=O)[O-])cc(C(=O)Nc2ccc3sc(CO)nc3c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15N5O6S/c1-20(2)16-12(21(25)26)5-9(6-13(16)22(27)28)17(24)18-10-3-4-14-11(7-10)19-15(8-23)29-14/h3-7,23H,8H2,1-2H3,(H,18,24) |
| InChIKey | UJYOBWWZHUWHHB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 151.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)-N-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-3,5-dinitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-N-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-3,5-dinitrobenzamide?
The IUPAC name of 4-(dimethylamino)-N-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-3,5-dinitrobenzamide (CID 11502581) is 4-(dimethylamino)-N-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-3,5-dinitrobenzamide.
What is the SMILES notation for 4-(dimethylamino)-N-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-3,5-dinitrobenzamide?
The canonical SMILES for 4-(dimethylamino)-N-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-3,5-dinitrobenzamide is CN(C)c1c([N+](=O)[O-])cc(C(=O)Nc2ccc3sc(CO)nc3c2)cc1[N+](=O)[O-].
What is the InChIKey of 4-(dimethylamino)-N-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-3,5-dinitrobenzamide?
The InChIKey is UJYOBWWZHUWHHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N5O6S/c1-20(2)16-12(21(25)26)5-9(6-13(16)22(27)28)17(24)18-10-3-4-14-11(7-10)19-15(8-23)29-14/h3-7,23H,8H2,1-2H3,(H,18,24).
What are the key properties of 4-(dimethylamino)-N-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-3,5-dinitrobenzamide?
4-(dimethylamino)-N-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-3,5-dinitrobenzamide has a molecular weight of 417.40 g/mol, XLogP of 2.92, 6 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-N-[2-(hydroxymethyl)-1,3-benzothiazol-5-yl]-3,5-dinitrobenzamide is sourced from PubChem (CID 11502581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).