About 7-chloro-3-isocyanato-3,4-dihydro-2H-chromene
7-chloro-3-isocyanato-3,4-dihydro-2H-chromene (PubChem CID 115026637) has the molecular formula C10H8ClNO2
and a molecular weight of 209.63 g/mol. Its IUPAC name is 7-chloro-3-isocyanato-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 7-chloro-3-isocyanato-3,4-dihydro-2H-chromene |
| PubChem CID | 115026637 |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.63 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | 7-chloro-3-isocyanato-3,4-dihydro-2H-chromene |
| SMILES | O=C=NC1COc2cc(Cl)ccc2C1 |
| InChI | InChI=1S/C10H8ClNO2/c11-8-2-1-7-3-9(12-6-13)5-14-10(7)4-8/h1-2,4,9H,3,5H2 |
| InChIKey | VYQPFEQCNWGASS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.63 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-3-isocyanato-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3-isocyanato-3,4-dihydro-2H-chromene?
The IUPAC name of 7-chloro-3-isocyanato-3,4-dihydro-2H-chromene (CID 115026637) is 7-chloro-3-isocyanato-3,4-dihydro-2H-chromene.
What is the SMILES notation for 7-chloro-3-isocyanato-3,4-dihydro-2H-chromene?
The canonical SMILES for 7-chloro-3-isocyanato-3,4-dihydro-2H-chromene is O=C=NC1COc2cc(Cl)ccc2C1.
What is the InChIKey of 7-chloro-3-isocyanato-3,4-dihydro-2H-chromene?
The InChIKey is VYQPFEQCNWGASS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClNO2/c11-8-2-1-7-3-9(12-6-13)5-14-10(7)4-8/h1-2,4,9H,3,5H2.
What are the key properties of 7-chloro-3-isocyanato-3,4-dihydro-2H-chromene?
7-chloro-3-isocyanato-3,4-dihydro-2H-chromene has a molecular weight of 209.63 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3-isocyanato-3,4-dihydro-2H-chromene is sourced from PubChem (CID 115026637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).