C19H31N7O4 — CID 11502686
N-hydroxy-N-[[(5R)-16-morpholin-4-yl-4-oxo-2,3,15,17,18-pentazabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-5-yl]methyl]formamide (PubChem CID 11502686) has the molecular formula C19H31N7O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-hydroxy-N-[[(5R)-16-morpholin-4-yl-4-oxo-2,3,15,17,18-pentazabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-5-yl]methyl]formamide.
| Compound Name | N-hydroxy-N-[[(5R)-16-morpholin-4-yl-4-oxo-2,3,15,17,18-pentazabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-5-yl]methyl]formamide |
|---|---|
| PubChem CID | 11502686 |
| Molecular Formula | C19H31N7O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | N-hydroxy-N-[[(5R)-16-morpholin-4-yl-4-oxo-2,3,15,17,18-pentazabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-5-yl]methyl]formamide |
| SMILES | O=CN(O)C[C@H]1CCCCCCCCc2nc(nc(N3CCOCC3)n2)NNC1=O |
| InChI | InChI=1S/C19H31N7O4/c27-14-26(29)13-15-7-5-3-1-2-4-6-8-16-20-18(24-23-17(15)28)22-19(21-16)25-9-11-30-12-10-25/h14-15,29H,1-13H2,(H,23,28)(H,20,21,22,24)/t15-/m1/s1 |
| InChIKey | BQIGFWOBZPZOMR-OAHLLOKOSA-N |
| XLogP | 0.90 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|