About 2-[5-methyl-4-(oxan-3-yl)-1,3-oxazol-2-yl]ethanamine
2-[5-methyl-4-(oxan-3-yl)-1,3-oxazol-2-yl]ethanamine (PubChem CID 115026955) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-[5-methyl-4-(oxan-3-yl)-1,3-oxazol-2-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[5-methyl-4-(oxan-3-yl)-1,3-oxazol-2-yl]ethanamine |
| PubChem CID | 115026955 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-[5-methyl-4-(oxan-3-yl)-1,3-oxazol-2-yl]ethanamine |
| SMILES | Cc1oc(CCN)nc1C1CCCOC1 |
| InChI | InChI=1S/C11H18N2O2/c1-8-11(9-3-2-6-14-7-9)13-10(15-8)4-5-12/h9H,2-7,12H2,1H3 |
| InChIKey | VZBCVEFYESODFM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-methyl-4-(oxan-3-yl)-1,3-oxazol-2-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-methyl-4-(oxan-3-yl)-1,3-oxazol-2-yl]ethanamine?
The IUPAC name of 2-[5-methyl-4-(oxan-3-yl)-1,3-oxazol-2-yl]ethanamine (CID 115026955) is 2-[5-methyl-4-(oxan-3-yl)-1,3-oxazol-2-yl]ethanamine.
What is the SMILES notation for 2-[5-methyl-4-(oxan-3-yl)-1,3-oxazol-2-yl]ethanamine?
The canonical SMILES for 2-[5-methyl-4-(oxan-3-yl)-1,3-oxazol-2-yl]ethanamine is Cc1oc(CCN)nc1C1CCCOC1.
What is the InChIKey of 2-[5-methyl-4-(oxan-3-yl)-1,3-oxazol-2-yl]ethanamine?
The InChIKey is VZBCVEFYESODFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-8-11(9-3-2-6-14-7-9)13-10(15-8)4-5-12/h9H,2-7,12H2,1H3.
What are the key properties of 2-[5-methyl-4-(oxan-3-yl)-1,3-oxazol-2-yl]ethanamine?
2-[5-methyl-4-(oxan-3-yl)-1,3-oxazol-2-yl]ethanamine has a molecular weight of 210.28 g/mol, XLogP of 1.38, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-methyl-4-(oxan-3-yl)-1,3-oxazol-2-yl]ethanamine is sourced from PubChem (CID 115026955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).