C11H18N2S — CID 115027129
[5-(1-methylcyclohexyl)-1,3-thiazol-2-yl]methanamine (PubChem CID 115027129) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is [5-(1-methylcyclohexyl)-1,3-thiazol-2-yl]methanamine.
| Compound Name | [5-(1-methylcyclohexyl)-1,3-thiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 115027129 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | [5-(1-methylcyclohexyl)-1,3-thiazol-2-yl]methanamine |
| SMILES | CC1(c2cnc(CN)s2)CCCCC1 |
| InChI | InChI=1S/C11H18N2S/c1-11(5-3-2-4-6-11)9-8-13-10(7-12)14-9/h8H,2-7,12H2,1H3 |
| InChIKey | AMGHRDUNLTZQRT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |