About 2-(3,7,7-trimethyl-3-azabicyclo[3.3.1]nonan-9-yl)ethanamine
2-(3,7,7-trimethyl-3-azabicyclo[3.3.1]nonan-9-yl)ethanamine (PubChem CID 115027150) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is 2-(3,7,7-trimethyl-3-azabicyclo[3.3.1]nonan-9-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(3,7,7-trimethyl-3-azabicyclo[3.3.1]nonan-9-yl)ethanamine |
| PubChem CID | 115027150 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 2-(3,7,7-trimethyl-3-azabicyclo[3.3.1]nonan-9-yl)ethanamine |
| SMILES | CN1CC2CC(C)(C)CC(C1)C2CCN |
| InChI | InChI=1S/C13H26N2/c1-13(2)6-10-8-15(3)9-11(7-13)12(10)4-5-14/h10-12H,4-9,14H2,1-3H3 |
| InChIKey | NFMQORMBADCFMG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,7,7-trimethyl-3-azabicyclo[3.3.1]nonan-9-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,7,7-trimethyl-3-azabicyclo[3.3.1]nonan-9-yl)ethanamine?
The IUPAC name of 2-(3,7,7-trimethyl-3-azabicyclo[3.3.1]nonan-9-yl)ethanamine (CID 115027150) is 2-(3,7,7-trimethyl-3-azabicyclo[3.3.1]nonan-9-yl)ethanamine.
What is the SMILES notation for 2-(3,7,7-trimethyl-3-azabicyclo[3.3.1]nonan-9-yl)ethanamine?
The canonical SMILES for 2-(3,7,7-trimethyl-3-azabicyclo[3.3.1]nonan-9-yl)ethanamine is CN1CC2CC(C)(C)CC(C1)C2CCN.
What is the InChIKey of 2-(3,7,7-trimethyl-3-azabicyclo[3.3.1]nonan-9-yl)ethanamine?
The InChIKey is NFMQORMBADCFMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2/c1-13(2)6-10-8-15(3)9-11(7-13)12(10)4-5-14/h10-12H,4-9,14H2,1-3H3.
What are the key properties of 2-(3,7,7-trimethyl-3-azabicyclo[3.3.1]nonan-9-yl)ethanamine?
2-(3,7,7-trimethyl-3-azabicyclo[3.3.1]nonan-9-yl)ethanamine has a molecular weight of 210.36 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,7,7-trimethyl-3-azabicyclo[3.3.1]nonan-9-yl)ethanamine is sourced from PubChem (CID 115027150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).