C8H7NO4S — CID 115028183
2,2-dioxo-1H-4,2λ6,1-benzoxathiazine-7-carbaldehyde (PubChem CID 115028183) has the molecular formula C8H7NO4S and a molecular weight of 213.21 g/mol. Its IUPAC name is 2,2-dioxo-1H-4,2λ6,1-benzoxathiazine-7-carbaldehyde.
| Compound Name | 2,2-dioxo-1H-4,2λ6,1-benzoxathiazine-7-carbaldehyde |
|---|---|
| PubChem CID | 115028183 |
| Molecular Formula | C8H7NO4S |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | 2,2-dioxo-1H-4,2λ6,1-benzoxathiazine-7-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1)NS(=O)(=O)CO2 |
| InChI | InChI=1S/C8H7NO4S/c10-4-6-1-2-8-7(3-6)9-14(11,12)5-13-8/h1-4,9H,5H2 |
| InChIKey | LRBSBKMZMCTKMQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|