About 3-piperidin-2-ylphenol;hydrochloride
3-piperidin-2-ylphenol;hydrochloride (PubChem CID 115028551) has the molecular formula C11H16ClNO
and a molecular weight of 213.71 g/mol. Its IUPAC name is 3-piperidin-2-ylphenol;hydrochloride.
Molecular Properties
| Compound Name | 3-piperidin-2-ylphenol;hydrochloride |
| PubChem CID | 115028551 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 3-piperidin-2-ylphenol;hydrochloride |
| SMILES | Cl.Oc1cccc(C2CCCCN2)c1 |
| InChI | InChI=1S/C11H15NO.ClH/c13-10-5-3-4-9(8-10)11-6-1-2-7-12-11;/h3-5,8,11-13H,1-2,6-7H2;1H |
| InChIKey | CQWQCQZQXDNUEM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-piperidin-2-ylphenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-2-ylphenol;hydrochloride?
The IUPAC name of 3-piperidin-2-ylphenol;hydrochloride (CID 115028551) is 3-piperidin-2-ylphenol;hydrochloride.
What is the SMILES notation for 3-piperidin-2-ylphenol;hydrochloride?
The canonical SMILES for 3-piperidin-2-ylphenol;hydrochloride is Cl.Oc1cccc(C2CCCCN2)c1.
What is the InChIKey of 3-piperidin-2-ylphenol;hydrochloride?
The InChIKey is CQWQCQZQXDNUEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO.ClH/c13-10-5-3-4-9(8-10)11-6-1-2-7-12-11;/h3-5,8,11-13H,1-2,6-7H2;1H.
What are the key properties of 3-piperidin-2-ylphenol;hydrochloride?
3-piperidin-2-ylphenol;hydrochloride has a molecular weight of 213.71 g/mol, XLogP of 2.63, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-2-ylphenol;hydrochloride is sourced from PubChem (CID 115028551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).