C12H14N4 — CID 115028784
5-[1-(3-methylphenyl)cyclopropyl]-1H-1,2,4-triazol-3-amine (PubChem CID 115028784) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 5-[1-(3-methylphenyl)cyclopropyl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[1-(3-methylphenyl)cyclopropyl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 115028784 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 5-[1-(3-methylphenyl)cyclopropyl]-1H-1,2,4-triazol-3-amine |
| SMILES | Cc1cccc(C2(c3nc(N)n[nH]3)CC2)c1 |
| InChI | InChI=1S/C12H14N4/c1-8-3-2-4-9(7-8)12(5-6-12)10-14-11(13)16-15-10/h2-4,7H,5-6H2,1H3,(H3,13,14,15,16) |
| InChIKey | YOSQLCYXULYQRF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |