C20H21FN4O4S — CID 11502912
4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methyl-6-(3-methylsulfonylpropoxy)pyrrolo[2,1-f][1,2,4]triazine (PubChem CID 11502912) has the molecular formula C20H21FN4O4S and a molecular weight of 432.48 g/mol. Its IUPAC name is 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methyl-6-(3-methylsulfonylpropoxy)pyrrolo[2,1-f][1,2,4]triazine.
| Compound Name | 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methyl-6-(3-methylsulfonylpropoxy)pyrrolo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 11502912 |
| Molecular Formula | C20H21FN4O4S |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-methyl-6-(3-methylsulfonylpropoxy)pyrrolo[2,1-f][1,2,4]triazine |
| SMILES | Cc1cc2c(F)c(Oc3ncnn4cc(OCCCS(C)(=O)=O)c(C)c34)ccc2[nH]1 |
| InChI | InChI=1S/C20H21FN4O4S/c1-12-9-14-15(24-12)5-6-16(18(14)21)29-20-19-13(2)17(10-25(19)23-11-22-20)28-7-4-8-30(3,26)27/h5-6,9-11,24H,4,7-8H2,1-3H3 |
| InChIKey | DZEADOQXGYJGID-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|