C11H13N3O2 — CID 115031242
4-[3-(aminomethyl)-4-methoxyphenyl]-1,3-oxazol-2-amine (PubChem CID 115031242) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 4-[3-(aminomethyl)-4-methoxyphenyl]-1,3-oxazol-2-amine.
| Compound Name | 4-[3-(aminomethyl)-4-methoxyphenyl]-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 115031242 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 4-[3-(aminomethyl)-4-methoxyphenyl]-1,3-oxazol-2-amine |
| SMILES | COc1ccc(-c2coc(N)n2)cc1CN |
| InChI | InChI=1S/C11H13N3O2/c1-15-10-3-2-7(4-8(10)5-12)9-6-16-11(13)14-9/h2-4,6H,5,12H2,1H3,(H2,13,14) |
| InChIKey | LAKYYVGGWPIWNB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |