C10H8N2O4 — CID 115031785
2-(9-hydroxy-4-oxopyrido[1,2-a]pyrimidin-2-yl)acetic acid (PubChem CID 115031785) has the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. Its IUPAC name is 2-(9-hydroxy-4-oxopyrido[1,2-a]pyrimidin-2-yl)acetic acid.
| Compound Name | 2-(9-hydroxy-4-oxopyrido[1,2-a]pyrimidin-2-yl)acetic acid |
|---|---|
| PubChem CID | 115031785 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-(9-hydroxy-4-oxopyrido[1,2-a]pyrimidin-2-yl)acetic acid |
| SMILES | O=C(O)Cc1cc(=O)n2cccc(O)c2n1 |
| InChI | InChI=1S/C10H8N2O4/c13-7-2-1-3-12-8(14)4-6(5-9(15)16)11-10(7)12/h1-4,13H,5H2,(H,15,16) |
| InChIKey | PCWYHKVOMUIHCN-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |