About 3-[4-(3-fluorophenyl)-1,3-oxazol-2-yl]propan-1-amine
3-[4-(3-fluorophenyl)-1,3-oxazol-2-yl]propan-1-amine (PubChem CID 115031927) has the molecular formula C12H13FN2O
and a molecular weight of 220.25 g/mol. Its IUPAC name is 3-[4-(3-fluorophenyl)-1,3-oxazol-2-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[4-(3-fluorophenyl)-1,3-oxazol-2-yl]propan-1-amine |
| PubChem CID | 115031927 |
| Molecular Formula | C12H13FN2O |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 3-[4-(3-fluorophenyl)-1,3-oxazol-2-yl]propan-1-amine |
| SMILES | NCCCc1nc(-c2cccc(F)c2)co1 |
| InChI | InChI=1S/C12H13FN2O/c13-10-4-1-3-9(7-10)11-8-16-12(15-11)5-2-6-14/h1,3-4,7-8H,2,5-6,14H2 |
| InChIKey | GCTAGYRUAZCSJL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-(3-fluorophenyl)-1,3-oxazol-2-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3-fluorophenyl)-1,3-oxazol-2-yl]propan-1-amine?
The IUPAC name of 3-[4-(3-fluorophenyl)-1,3-oxazol-2-yl]propan-1-amine (CID 115031927) is 3-[4-(3-fluorophenyl)-1,3-oxazol-2-yl]propan-1-amine.
What is the SMILES notation for 3-[4-(3-fluorophenyl)-1,3-oxazol-2-yl]propan-1-amine?
The canonical SMILES for 3-[4-(3-fluorophenyl)-1,3-oxazol-2-yl]propan-1-amine is NCCCc1nc(-c2cccc(F)c2)co1.
What is the InChIKey of 3-[4-(3-fluorophenyl)-1,3-oxazol-2-yl]propan-1-amine?
The InChIKey is GCTAGYRUAZCSJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2O/c13-10-4-1-3-9(7-10)11-8-16-12(15-11)5-2-6-14/h1,3-4,7-8H,2,5-6,14H2.
What are the key properties of 3-[4-(3-fluorophenyl)-1,3-oxazol-2-yl]propan-1-amine?
3-[4-(3-fluorophenyl)-1,3-oxazol-2-yl]propan-1-amine has a molecular weight of 220.25 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3-fluorophenyl)-1,3-oxazol-2-yl]propan-1-amine is sourced from PubChem (CID 115031927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).