C22H40O7Si — CID 11503194
[(3'aR,4S,4'S,6'R,7'aS)-6'-(methoxymethoxy)-2,2,2',2'-tetramethyl-5'-methylidenespiro[1,3-dioxolane-4,7'-3a,4,6,7a-tetrahydro-1,3-benzodioxole]-4'-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11503194) has the molecular formula C22H40O7Si and a molecular weight of 444.64 g/mol. Its IUPAC name is [(3'aR,4S,4'S,6'R,7'aS)-6'-(methoxymethoxy)-2,2,2',2'-tetramethyl-5'-methylidenespiro[1,3-dioxolane-4,7'-3a,4,6,7a-tetrahydro-1,3-benzodioxole]-4'-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3'aR,4S,4'S,6'R,7'aS)-6'-(methoxymethoxy)-2,2,2',2'-tetramethyl-5'-methylidenespiro[1,3-dioxolane-4,7'-3a,4,6,7a-tetrahydro-1,3-benzodioxole]-4'-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11503194 |
| Molecular Formula | C22H40O7Si |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | [(3'aR,4S,4'S,6'R,7'aS)-6'-(methoxymethoxy)-2,2,2',2'-tetramethyl-5'-methylidenespiro[1,3-dioxolane-4,7'-3a,4,6,7a-tetrahydro-1,3-benzodioxole]-4'-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C1[C@@H](OCOC)[C@@]2(COC(C)(C)O2)[C@H]2OC(C)(C)O[C@H]2[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O7Si/c1-14-15(28-30(10,11)19(2,3)4)16-18(27-21(7,8)26-16)22(17(14)24-13-23-9)12-25-20(5,6)29-22/h15-18H,1,12-13H2,2-11H3/t15-,16-,17+,18-,22-/m0/s1 |
| InChIKey | IONVJBKKHBOFHD-ARNOYJHMSA-N |
| XLogP | 3.98 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|