About [3,3-difluoro-1-(thian-4-yl)cyclobutyl]methanamine
[3,3-difluoro-1-(thian-4-yl)cyclobutyl]methanamine (PubChem CID 115032891) has the molecular formula C10H17F2NS
and a molecular weight of 221.32 g/mol. Its IUPAC name is [3,3-difluoro-1-(thian-4-yl)cyclobutyl]methanamine.
Molecular Properties
| Compound Name | [3,3-difluoro-1-(thian-4-yl)cyclobutyl]methanamine |
| PubChem CID | 115032891 |
| Molecular Formula | C10H17F2NS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | [3,3-difluoro-1-(thian-4-yl)cyclobutyl]methanamine |
| SMILES | NCC1(C2CCSCC2)CC(F)(F)C1 |
| InChI | InChI=1S/C10H17F2NS/c11-10(12)5-9(6-10,7-13)8-1-3-14-4-2-8/h8H,1-7,13H2 |
| InChIKey | UBGHFKKZHGTDEZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3,3-difluoro-1-(thian-4-yl)cyclobutyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,3-difluoro-1-(thian-4-yl)cyclobutyl]methanamine?
The IUPAC name of [3,3-difluoro-1-(thian-4-yl)cyclobutyl]methanamine (CID 115032891) is [3,3-difluoro-1-(thian-4-yl)cyclobutyl]methanamine.
What is the SMILES notation for [3,3-difluoro-1-(thian-4-yl)cyclobutyl]methanamine?
The canonical SMILES for [3,3-difluoro-1-(thian-4-yl)cyclobutyl]methanamine is NCC1(C2CCSCC2)CC(F)(F)C1.
What is the InChIKey of [3,3-difluoro-1-(thian-4-yl)cyclobutyl]methanamine?
The InChIKey is UBGHFKKZHGTDEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NS/c11-10(12)5-9(6-10,7-13)8-1-3-14-4-2-8/h8H,1-7,13H2.
What are the key properties of [3,3-difluoro-1-(thian-4-yl)cyclobutyl]methanamine?
[3,3-difluoro-1-(thian-4-yl)cyclobutyl]methanamine has a molecular weight of 221.32 g/mol, XLogP of 2.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3,3-difluoro-1-(thian-4-yl)cyclobutyl]methanamine is sourced from PubChem (CID 115032891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).