About dibutyltin;2-[(2-hydroxycyclohexyl)amino]-4-methylphenol
dibutyltin;2-[(2-hydroxycyclohexyl)amino]-4-methylphenol (PubChem CID 11503354) has the molecular formula C21H37NO2Sn
and a molecular weight of 454.24 g/mol. Its IUPAC name is dibutyltin;2-[(2-hydroxycyclohexyl)amino]-4-methylphenol.
Molecular Properties
| Compound Name | dibutyltin;2-[(2-hydroxycyclohexyl)amino]-4-methylphenol |
| PubChem CID | 11503354 |
| Molecular Formula | C21H37NO2Sn |
| Molecular Weight | 454.24 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | dibutyltin;2-[(2-hydroxycyclohexyl)amino]-4-methylphenol |
| SMILES | CCCC[Sn]CCCC.Cc1ccc(O)c(NC2CCCCC2O)c1 |
| InChI | InChI=1S/C13H19NO2.2C4H9.Sn/c1-9-6-7-13(16)11(8-9)14-10-4-2-3-5-12(10)15;2*1-3-4-2;/h6-8,10,12,14-16H,2-5H2,1H3;2*1,3-4H2,2H3; |
| InChIKey | MJZQFQUZDIOZCN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.24 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze dibutyltin;2-[(2-hydroxycyclohexyl)amino]-4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyltin;2-[(2-hydroxycyclohexyl)amino]-4-methylphenol?
The IUPAC name of dibutyltin;2-[(2-hydroxycyclohexyl)amino]-4-methylphenol (CID 11503354) is dibutyltin;2-[(2-hydroxycyclohexyl)amino]-4-methylphenol.
What is the SMILES notation for dibutyltin;2-[(2-hydroxycyclohexyl)amino]-4-methylphenol?
The canonical SMILES for dibutyltin;2-[(2-hydroxycyclohexyl)amino]-4-methylphenol is CCCC[Sn]CCCC.Cc1ccc(O)c(NC2CCCCC2O)c1.
What is the InChIKey of dibutyltin;2-[(2-hydroxycyclohexyl)amino]-4-methylphenol?
The InChIKey is MJZQFQUZDIOZCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2.2C4H9.Sn/c1-9-6-7-13(16)11(8-9)14-10-4-2-3-5-12(10)15;2*1-3-4-2;/h6-8,10,12,14-16H,2-5H2,1H3;2*1,3-4H2,2H3;.
What are the key properties of dibutyltin;2-[(2-hydroxycyclohexyl)amino]-4-methylphenol?
dibutyltin;2-[(2-hydroxycyclohexyl)amino]-4-methylphenol has a molecular weight of 454.24 g/mol, XLogP of 5.54, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyltin;2-[(2-hydroxycyclohexyl)amino]-4-methylphenol is sourced from PubChem (CID 11503354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).