C26H31NO6 — CID 11503381
ethyl (2S,3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzylaziridine-2-carboxylate (PubChem CID 11503381) has the molecular formula C26H31NO6 and a molecular weight of 453.54 g/mol. Its IUPAC name is ethyl (2S,3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzylaziridine-2-carboxylate.
| Compound Name | ethyl (2S,3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 11503381 |
| Molecular Formula | C26H31NO6 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | ethyl (2S,3S)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-benzylaziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]([C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2OCc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C26H31NO6/c1-4-29-24(28)20-19(27(20)15-17-11-7-5-8-12-17)21-22(30-16-18-13-9-6-10-14-18)23-25(31-21)33-26(2,3)32-23/h5-14,19-23,25H,4,15-16H2,1-3H3/t19-,20-,21+,22-,23+,25+,27?/m0/s1 |
| InChIKey | BTEBAHHDQUEHFI-XLBYXVEASA-N |
| XLogP | 3.26 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|