About 3-[5-(thian-4-yl)-1,3-oxazol-2-yl]propan-1-ol
3-[5-(thian-4-yl)-1,3-oxazol-2-yl]propan-1-ol (PubChem CID 115036302) has the molecular formula C11H17NO2S
and a molecular weight of 227.33 g/mol. Its IUPAC name is 3-[5-(thian-4-yl)-1,3-oxazol-2-yl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[5-(thian-4-yl)-1,3-oxazol-2-yl]propan-1-ol |
| PubChem CID | 115036302 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 3-[5-(thian-4-yl)-1,3-oxazol-2-yl]propan-1-ol |
| SMILES | OCCCc1ncc(C2CCSCC2)o1 |
| InChI | InChI=1S/C11H17NO2S/c13-5-1-2-11-12-8-10(14-11)9-3-6-15-7-4-9/h8-9,13H,1-7H2 |
| InChIKey | GRBCCTMPTVDLHH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[5-(thian-4-yl)-1,3-oxazol-2-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(thian-4-yl)-1,3-oxazol-2-yl]propan-1-ol?
The IUPAC name of 3-[5-(thian-4-yl)-1,3-oxazol-2-yl]propan-1-ol (CID 115036302) is 3-[5-(thian-4-yl)-1,3-oxazol-2-yl]propan-1-ol.
What is the SMILES notation for 3-[5-(thian-4-yl)-1,3-oxazol-2-yl]propan-1-ol?
The canonical SMILES for 3-[5-(thian-4-yl)-1,3-oxazol-2-yl]propan-1-ol is OCCCc1ncc(C2CCSCC2)o1.
What is the InChIKey of 3-[5-(thian-4-yl)-1,3-oxazol-2-yl]propan-1-ol?
The InChIKey is GRBCCTMPTVDLHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2S/c13-5-1-2-11-12-8-10(14-11)9-3-6-15-7-4-9/h8-9,13H,1-7H2.
What are the key properties of 3-[5-(thian-4-yl)-1,3-oxazol-2-yl]propan-1-ol?
3-[5-(thian-4-yl)-1,3-oxazol-2-yl]propan-1-ol has a molecular weight of 227.33 g/mol, XLogP of 2.21, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(thian-4-yl)-1,3-oxazol-2-yl]propan-1-ol is sourced from PubChem (CID 115036302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).