C25H33N3O4S — CID 11503764
2-[[2-(3-piperidin-1-ylpropylamino)phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid (PubChem CID 11503764) has the molecular formula C25H33N3O4S and a molecular weight of 471.62 g/mol. Its IUPAC name is 2-[[2-(3-piperidin-1-ylpropylamino)phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid.
| Compound Name | 2-[[2-(3-piperidin-1-ylpropylamino)phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 11503764 |
| Molecular Formula | C25H33N3O4S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 2-[[2-(3-piperidin-1-ylpropylamino)phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
| SMILES | O=C(O)c1c(NS(=O)(=O)c2ccccc2NCCCN2CCCCC2)ccc2c1CCCC2 |
| InChI | InChI=1S/C25H33N3O4S/c29-25(30)24-20-10-3-2-9-19(20)13-14-22(24)27-33(31,32)23-12-5-4-11-21(23)26-15-8-18-28-16-6-1-7-17-28/h4-5,11-14,26-27H,1-3,6-10,15-18H2,(H,29,30) |
| InChIKey | RTRXMZICIAUILM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|