C8H10N2O4S — CID 115037661
5-(3-methyl-1,1-dioxothiolan-3-yl)-1,3,4-oxadiazole-2-carbaldehyde (PubChem CID 115037661) has the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. Its IUPAC name is 5-(3-methyl-1,1-dioxothiolan-3-yl)-1,3,4-oxadiazole-2-carbaldehyde.
| Compound Name | 5-(3-methyl-1,1-dioxothiolan-3-yl)-1,3,4-oxadiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 115037661 |
| Molecular Formula | C8H10N2O4S |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 5-(3-methyl-1,1-dioxothiolan-3-yl)-1,3,4-oxadiazole-2-carbaldehyde |
| SMILES | CC1(c2nnc(C=O)o2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H10N2O4S/c1-8(2-3-15(12,13)5-8)7-10-9-6(4-11)14-7/h4H,2-3,5H2,1H3 |
| InChIKey | IIMRFECMUULQBC-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 90.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|