About 5-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazol-2-amine
5-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazol-2-amine (PubChem CID 115037812) has the molecular formula C9H14N2O3S
and a molecular weight of 230.29 g/mol. Its IUPAC name is 5-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | 5-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazol-2-amine |
| PubChem CID | 115037812 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 5-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazol-2-amine |
| SMILES | CC1(c2cnc(N)o2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H14N2O3S/c1-9(7-6-11-8(10)14-7)2-4-15(12,13)5-3-9/h6H,2-5H2,1H3,(H2,10,11) |
| InChIKey | DJIHPDJPHHKHBC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazol-2-amine?
The IUPAC name of 5-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazol-2-amine (CID 115037812) is 5-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazol-2-amine.
What is the SMILES notation for 5-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazol-2-amine?
The canonical SMILES for 5-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazol-2-amine is CC1(c2cnc(N)o2)CCS(=O)(=O)CC1.
What is the InChIKey of 5-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazol-2-amine?
The InChIKey is DJIHPDJPHHKHBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3S/c1-9(7-6-11-8(10)14-7)2-4-15(12,13)5-3-9/h6H,2-5H2,1H3,(H2,10,11).
What are the key properties of 5-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazol-2-amine?
5-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazol-2-amine has a molecular weight of 230.29 g/mol, XLogP of 0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazol-2-amine is sourced from PubChem (CID 115037812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).