C12H13N3O2 — CID 115038189
9-hydroxy-2-pyrrolidin-3-ylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 115038189) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 9-hydroxy-2-pyrrolidin-3-ylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 9-hydroxy-2-pyrrolidin-3-ylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 115038189 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 9-hydroxy-2-pyrrolidin-3-ylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(C2CCNC2)nc2c(O)cccn12 |
| InChI | InChI=1S/C12H13N3O2/c16-10-2-1-5-15-11(17)6-9(14-12(10)15)8-3-4-13-7-8/h1-2,5-6,8,13,16H,3-4,7H2 |
| InChIKey | GGBWWNHTMJTEDN-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |