About 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2,2-difluoroacetic acid
2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2,2-difluoroacetic acid (PubChem CID 115038705) has the molecular formula C10H14F2N2O2
and a molecular weight of 232.23 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2,2-difluoroacetic acid.
Molecular Properties
| Compound Name | 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2,2-difluoroacetic acid |
| PubChem CID | 115038705 |
| Molecular Formula | C10H14F2N2O2 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2,2-difluoroacetic acid |
| SMILES | Cc1nn(C(C)C)c(C)c1C(F)(F)C(=O)O |
| InChI | InChI=1S/C10H14F2N2O2/c1-5(2)14-7(4)8(6(3)13-14)10(11,12)9(15)16/h5H,1-4H3,(H,15,16) |
| InChIKey | QUBIAVRIHKIVCT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2,2-difluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2,2-difluoroacetic acid?
The IUPAC name of 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2,2-difluoroacetic acid (CID 115038705) is 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2,2-difluoroacetic acid.
What is the SMILES notation for 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2,2-difluoroacetic acid?
The canonical SMILES for 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2,2-difluoroacetic acid is Cc1nn(C(C)C)c(C)c1C(F)(F)C(=O)O.
What is the InChIKey of 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2,2-difluoroacetic acid?
The InChIKey is QUBIAVRIHKIVCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2N2O2/c1-5(2)14-7(4)8(6(3)13-14)10(11,12)9(15)16/h5H,1-4H3,(H,15,16).
What are the key properties of 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2,2-difluoroacetic acid?
2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2,2-difluoroacetic acid has a molecular weight of 232.23 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-2,2-difluoroacetic acid is sourced from PubChem (CID 115038705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).