C29H23NO6 — CID 11503949
dimethyl 5-(2,6-dimethylphenyl)imino-10'-oxospiro[furan-2,9'-phenanthrene]-3,4-dicarboxylate (PubChem CID 11503949) has the molecular formula C29H23NO6 and a molecular weight of 481.50 g/mol. Its IUPAC name is dimethyl 5-(2,6-dimethylphenyl)imino-10'-oxospiro[furan-2,9'-phenanthrene]-3,4-dicarboxylate.
| Compound Name | dimethyl 5-(2,6-dimethylphenyl)imino-10'-oxospiro[furan-2,9'-phenanthrene]-3,4-dicarboxylate |
|---|---|
| PubChem CID | 11503949 |
| Molecular Formula | C29H23NO6 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | dimethyl 5-(2,6-dimethylphenyl)imino-10'-oxospiro[furan-2,9'-phenanthrene]-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(O/C1=N\c1c(C)cccc1C)C(=O)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C29H23NO6/c1-16-10-9-11-17(2)24(16)30-26-22(27(32)34-3)23(28(33)35-4)29(36-26)21-15-8-7-13-19(21)18-12-5-6-14-20(18)25(29)31/h5-15H,1-4H3/b30-26- |
| InChIKey | LPXNHUQLINZPMZ-BXVZCJGGSA-N |
| XLogP | 4.77 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|