C24H22ClN3O4S — CID 11503993
(7S)-3-chloro-2-[(2,5-dioxopyrrolidin-1-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxamide (PubChem CID 11503993) has the molecular formula C24H22ClN3O4S and a molecular weight of 483.98 g/mol. Its IUPAC name is (7S)-3-chloro-2-[(2,5-dioxopyrrolidin-1-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxamide.
| Compound Name | (7S)-3-chloro-2-[(2,5-dioxopyrrolidin-1-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 11503993 |
| Molecular Formula | C24H22ClN3O4S |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | (7S)-3-chloro-2-[(2,5-dioxopyrrolidin-1-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxamide |
| SMILES | COc1ccc(-c2c(Cl)c(CN3C(=O)CCC3=O)nc3sc4c(c23)CC[C@H](C(N)=O)C4)cc1 |
| InChI | InChI=1S/C24H22ClN3O4S/c1-32-14-5-2-12(3-6-14)20-21-15-7-4-13(23(26)31)10-17(15)33-24(21)27-16(22(20)25)11-28-18(29)8-9-19(28)30/h2-3,5-6,13H,4,7-11H2,1H3,(H2,26,31)/t13-/m0/s1 |
| InChIKey | GXAVIBSGCHCPNF-ZDUSSCGKSA-N |
| XLogP | 3.86 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|