C19H20Cl2N4O3S2 — CID 11504052
2-[4-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioyl]piperazin-1-yl]acetic acid (PubChem CID 11504052) has the molecular formula C19H20Cl2N4O3S2 and a molecular weight of 487.43 g/mol. Its IUPAC name is 2-[4-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 11504052 |
| Molecular Formula | C19H20Cl2N4O3S2 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | 2-[4-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioyl]piperazin-1-yl]acetic acid |
| SMILES | C/C(=N\NC(=S)N1CCN(CC(=O)O)CC1)c1csc(-c2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C19H20Cl2N4O3S2/c1-11(22-23-19(29)25-6-4-24(5-7-25)9-16(26)27)13-10-30-18(17(13)28)12-2-3-14(20)15(21)8-12/h2-3,8,10,28H,4-7,9H2,1H3,(H,23,29)(H,26,27)/b22-11+ |
| InChIKey | KYNVGWCQNSGRAP-SSDVNMTOSA-N |
| XLogP | 3.73 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|