C11H13F4N — CID 115040640
3-benzyl-3,4,4,4-tetrafluorobutan-1-amine (PubChem CID 115040640) has the molecular formula C11H13F4N and a molecular weight of 235.22 g/mol. Its IUPAC name is 3-benzyl-3,4,4,4-tetrafluorobutan-1-amine.
| Compound Name | 3-benzyl-3,4,4,4-tetrafluorobutan-1-amine |
|---|---|
| PubChem CID | 115040640 |
| Molecular Formula | C11H13F4N |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3-benzyl-3,4,4,4-tetrafluorobutan-1-amine |
| SMILES | NCCC(F)(Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H13F4N/c12-10(6-7-16,11(13,14)15)8-9-4-2-1-3-5-9/h1-5H,6-8,16H2 |
| InChIKey | QOCNAZHGGPFKEY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |