C23H21Cl2N3O3S — CID 11504113
2-[[4-[[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzoyl]-methylamino]acetic acid (PubChem CID 11504113) has the molecular formula C23H21Cl2N3O3S and a molecular weight of 490.41 g/mol. Its IUPAC name is 2-[[4-[[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzoyl]-methylamino]acetic acid.
| Compound Name | 2-[[4-[[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzoyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 11504113 |
| Molecular Formula | C23H21Cl2N3O3S |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 2-[[4-[[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzoyl]-methylamino]acetic acid |
| SMILES | C=CCN(Cc1ccc(C(=O)N(C)CC(=O)O)cc1)c1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C23H21Cl2N3O3S/c1-3-10-28(23-26-20(14-32-23)17-8-9-18(24)19(25)11-17)12-15-4-6-16(7-5-15)22(31)27(2)13-21(29)30/h3-9,11,14H,1,10,12-13H2,2H3,(H,29,30) |
| InChIKey | XIEAVUCGYLGZAG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|