C14H19FO2 — CID 115042618
2-[2-(2-fluoro-3,3-dimethylbutan-2-yl)phenyl]acetic acid (PubChem CID 115042618) has the molecular formula C14H19FO2 and a molecular weight of 238.30 g/mol. Its IUPAC name is 2-[2-(2-fluoro-3,3-dimethylbutan-2-yl)phenyl]acetic acid.
| Compound Name | 2-[2-(2-fluoro-3,3-dimethylbutan-2-yl)phenyl]acetic acid |
|---|---|
| PubChem CID | 115042618 |
| Molecular Formula | C14H19FO2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 2-[2-(2-fluoro-3,3-dimethylbutan-2-yl)phenyl]acetic acid |
| SMILES | CC(C)(C)C(C)(F)c1ccccc1CC(=O)O |
| InChI | InChI=1S/C14H19FO2/c1-13(2,3)14(4,15)11-8-6-5-7-10(11)9-12(16)17/h5-8H,9H2,1-4H3,(H,16,17) |
| InChIKey | VWVVWHJYOPBZJZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |