C24H37NO8S — CID 11504264
[(1R)-1-[(3aS,4S,6R,6aS)-4-heptoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethyl] N-(2-methylphenyl)sulfonylcarbamate (PubChem CID 11504264) has the molecular formula C24H37NO8S and a molecular weight of 499.63 g/mol. Its IUPAC name is [(1R)-1-[(3aS,4S,6R,6aS)-4-heptoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethyl] N-(2-methylphenyl)sulfonylcarbamate.
| Compound Name | [(1R)-1-[(3aS,4S,6R,6aS)-4-heptoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethyl] N-(2-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 11504264 |
| Molecular Formula | C24H37NO8S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | [(1R)-1-[(3aS,4S,6R,6aS)-4-heptoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethyl] N-(2-methylphenyl)sulfonylcarbamate |
| SMILES | CCCCCCCO[C@H]1O[C@H]([C@@H](C)OC(=O)NS(=O)(=O)c2ccccc2C)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C24H37NO8S/c1-6-7-8-9-12-15-29-22-21-20(32-24(4,5)33-21)19(31-22)17(3)30-23(26)25-34(27,28)18-14-11-10-13-16(18)2/h10-11,13-14,17,19-22H,6-9,12,15H2,1-5H3,(H,25,26)/t17-,19-,20+,21+,22+/m1/s1 |
| InChIKey | DJLBQKAZIVCFKG-ICGSVKGVSA-N |
| XLogP | 4.03 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|