C12H14ClNO2 — CID 115043367
3-(aminomethyl)-1-(4-chlorophenyl)cyclobutane-1-carboxylic acid (PubChem CID 115043367) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is 3-(aminomethyl)-1-(4-chlorophenyl)cyclobutane-1-carboxylic acid.
| Compound Name | 3-(aminomethyl)-1-(4-chlorophenyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 115043367 |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3-(aminomethyl)-1-(4-chlorophenyl)cyclobutane-1-carboxylic acid |
| SMILES | NCC1CC(C(=O)O)(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C12H14ClNO2/c13-10-3-1-9(2-4-10)12(11(15)16)5-8(6-12)7-14/h1-4,8H,5-7,14H2,(H,15,16) |
| InChIKey | UGVZNXRESSIWCU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |