About N-[4-(1,1-difluoroethyl)phenyl]piperidin-4-amine
N-[4-(1,1-difluoroethyl)phenyl]piperidin-4-amine (PubChem CID 115043703) has the molecular formula C13H18F2N2
and a molecular weight of 240.30 g/mol. Its IUPAC name is N-[4-(1,1-difluoroethyl)phenyl]piperidin-4-amine.
Molecular Properties
| Compound Name | N-[4-(1,1-difluoroethyl)phenyl]piperidin-4-amine |
| PubChem CID | 115043703 |
| Molecular Formula | C13H18F2N2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N-[4-(1,1-difluoroethyl)phenyl]piperidin-4-amine |
| SMILES | CC(F)(F)c1ccc(NC2CCNCC2)cc1 |
| InChI | InChI=1S/C13H18F2N2/c1-13(14,15)10-2-4-11(5-3-10)17-12-6-8-16-9-7-12/h2-5,12,16-17H,6-9H2,1H3 |
| InChIKey | UUGKWZUFXFRRHE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[4-(1,1-difluoroethyl)phenyl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(1,1-difluoroethyl)phenyl]piperidin-4-amine?
The IUPAC name of N-[4-(1,1-difluoroethyl)phenyl]piperidin-4-amine (CID 115043703) is N-[4-(1,1-difluoroethyl)phenyl]piperidin-4-amine.
What is the SMILES notation for N-[4-(1,1-difluoroethyl)phenyl]piperidin-4-amine?
The canonical SMILES for N-[4-(1,1-difluoroethyl)phenyl]piperidin-4-amine is CC(F)(F)c1ccc(NC2CCNCC2)cc1.
What is the InChIKey of N-[4-(1,1-difluoroethyl)phenyl]piperidin-4-amine?
The InChIKey is UUGKWZUFXFRRHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F2N2/c1-13(14,15)10-2-4-11(5-3-10)17-12-6-8-16-9-7-12/h2-5,12,16-17H,6-9H2,1H3.
What are the key properties of N-[4-(1,1-difluoroethyl)phenyl]piperidin-4-amine?
N-[4-(1,1-difluoroethyl)phenyl]piperidin-4-amine has a molecular weight of 240.30 g/mol, XLogP of 2.96, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(1,1-difluoroethyl)phenyl]piperidin-4-amine is sourced from PubChem (CID 115043703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).