3-[2-(3-methyloxolan-3-yl)-1,3-thiazol-5-yl]propanoic acid

C11H15NO3S — CID 115044310

IUPAC3-[2-(3-methyloxolan-3-yl)-1,3-thiazol-5-yl]propanoic acid
SMILESCC1(c2ncc(CCC(=O)O)s2)CCOC1
InChIInChI=1S/C11H15NO3S/c1-11(4-5-15-7-11)10-12-6-8(16-10)2-3-9(13)14/h6H,2-5,7H2,1H3,(H,13,14)
InChIKeyJPBZPCRKSONMJP-UHFFFAOYSA-N
MW241.31 g/mol
LogP1.84
Rot. Bonds4

About 3-[2-(3-methyloxolan-3-yl)-1,3-thiazol-5-yl]propanoic acid

3-[2-(3-methyloxolan-3-yl)-1,3-thiazol-5-yl]propanoic acid (PubChem CID 115044310) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 3-[2-(3-methyloxolan-3-yl)-1,3-thiazol-5-yl]propanoic acid.

Molecular Properties

Compound Name3-[2-(3-methyloxolan-3-yl)-1,3-thiazol-5-yl]propanoic acid
PubChem CID115044310
Molecular FormulaC11H15NO3S
Molecular Weight241.31 g/mol
Exact Mass241.08
IUPAC Name3-[2-(3-methyloxolan-3-yl)-1,3-thiazol-5-yl]propanoic acid
SMILESCC1(c2ncc(CCC(=O)O)s2)CCOC1
InChIInChI=1S/C11H15NO3S/c1-11(4-5-15-7-11)10-12-6-8(16-10)2-3-9(13)14/h6H,2-5,7H2,1H3,(H,13,14)
InChIKeyJPBZPCRKSONMJP-UHFFFAOYSA-N
XLogP1.84
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.31
LogP ≤ 51.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[2-(3-methyloxolan-3-yl)-1,3-thiazol-5-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(3-methyloxolan-3-yl)-1,3-thiazol-5-yl]propanoic acid?
The IUPAC name of 3-[2-(3-methyloxolan-3-yl)-1,3-thiazol-5-yl]propanoic acid (CID 115044310) is 3-[2-(3-methyloxolan-3-yl)-1,3-thiazol-5-yl]propanoic acid.
What is the SMILES notation for 3-[2-(3-methyloxolan-3-yl)-1,3-thiazol-5-yl]propanoic acid?
The canonical SMILES for 3-[2-(3-methyloxolan-3-yl)-1,3-thiazol-5-yl]propanoic acid is CC1(c2ncc(CCC(=O)O)s2)CCOC1.
What is the InChIKey of 3-[2-(3-methyloxolan-3-yl)-1,3-thiazol-5-yl]propanoic acid?
The InChIKey is JPBZPCRKSONMJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3S/c1-11(4-5-15-7-11)10-12-6-8(16-10)2-3-9(13)14/h6H,2-5,7H2,1H3,(H,13,14).
What are the key properties of 3-[2-(3-methyloxolan-3-yl)-1,3-thiazol-5-yl]propanoic acid?
3-[2-(3-methyloxolan-3-yl)-1,3-thiazol-5-yl]propanoic acid has a molecular weight of 241.31 g/mol, XLogP of 1.84, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3-methyloxolan-3-yl)-1,3-thiazol-5-yl]propanoic acid is sourced from PubChem (CID 115044310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).