C24H23ClN6O5 — CID 11504438
(3Z)-1-(4-chlorophenyl)-3-[1-hydroxy-3-[[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]carbamoylamino]-4-pyridinylidene]urea (PubChem CID 11504438) has the molecular formula C24H23ClN6O5 and a molecular weight of 510.94 g/mol. Its IUPAC name is (3Z)-1-(4-chlorophenyl)-3-[1-hydroxy-3-[[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]carbamoylamino]-4-pyridinylidene]urea.
| Compound Name | (3Z)-1-(4-chlorophenyl)-3-[1-hydroxy-3-[[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]carbamoylamino]-4-pyridinylidene]urea |
|---|---|
| PubChem CID | 11504438 |
| Molecular Formula | C24H23ClN6O5 |
| Molecular Weight | 510.94 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | (3Z)-1-(4-chlorophenyl)-3-[1-hydroxy-3-[[3-methyl-4-(3-oxomorpholin-4-yl)phenyl]carbamoylamino]-4-pyridinylidene]urea |
| SMILES | Cc1cc(NC(=O)Nc2cn(O)cc/c2=N/C(=O)Nc2ccc(Cl)cc2)ccc1N1CCOCC1=O |
| InChI | InChI=1S/C24H23ClN6O5/c1-15-12-18(6-7-21(15)31-10-11-36-14-22(31)32)27-24(34)29-20-13-30(35)9-8-19(20)28-23(33)26-17-4-2-16(25)3-5-17/h2-9,12-13,35H,10-11,14H2,1H3,(H,26,33)(H2,27,29,34)/b28-19- |
| InChIKey | ATBUZBYKVJBPCM-USHMODERSA-N |
| XLogP | 3.83 |
| TPSA | 137.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.94 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|