About 6-(trifluoromethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-2-ol
6-(trifluoromethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-2-ol (PubChem CID 115044600) has the molecular formula C11H9F3N2O
and a molecular weight of 242.20 g/mol. Its IUPAC name is 6-(trifluoromethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-2-ol.
Molecular Properties
| Compound Name | 6-(trifluoromethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-2-ol |
| PubChem CID | 115044600 |
| Molecular Formula | C11H9F3N2O |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 6-(trifluoromethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-2-ol |
| SMILES | OC1Cc2nc3cc(C(F)(F)F)ccc3n2C1 |
| InChI | InChI=1S/C11H9F3N2O/c12-11(13,14)6-1-2-9-8(3-6)15-10-4-7(17)5-16(9)10/h1-3,7,17H,4-5H2 |
| InChIKey | WBURBEARFPBHHE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(trifluoromethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(trifluoromethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-2-ol?
The IUPAC name of 6-(trifluoromethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-2-ol (CID 115044600) is 6-(trifluoromethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-2-ol.
What is the SMILES notation for 6-(trifluoromethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-2-ol?
The canonical SMILES for 6-(trifluoromethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-2-ol is OC1Cc2nc3cc(C(F)(F)F)ccc3n2C1.
What is the InChIKey of 6-(trifluoromethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-2-ol?
The InChIKey is WBURBEARFPBHHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F3N2O/c12-11(13,14)6-1-2-9-8(3-6)15-10-4-7(17)5-16(9)10/h1-3,7,17H,4-5H2.
What are the key properties of 6-(trifluoromethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-2-ol?
6-(trifluoromethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-2-ol has a molecular weight of 242.20 g/mol, XLogP of 1.97, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(trifluoromethyl)-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-2-ol is sourced from PubChem (CID 115044600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).