About 2-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazole-4-carbaldehyde
2-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazole-4-carbaldehyde (PubChem CID 115044989) has the molecular formula C10H13NO4S
and a molecular weight of 243.28 g/mol. Its IUPAC name is 2-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 2-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazole-4-carbaldehyde |
| PubChem CID | 115044989 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazole-4-carbaldehyde |
| SMILES | CC1(c2nc(C=O)co2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H13NO4S/c1-10(2-4-16(13,14)5-3-10)9-11-8(6-12)7-15-9/h6-7H,2-5H2,1H3 |
| InChIKey | NTURAGZYGBJKCT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 77.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazole-4-carbaldehyde?
The IUPAC name of 2-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazole-4-carbaldehyde (CID 115044989) is 2-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazole-4-carbaldehyde.
What is the SMILES notation for 2-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazole-4-carbaldehyde?
The canonical SMILES for 2-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazole-4-carbaldehyde is CC1(c2nc(C=O)co2)CCS(=O)(=O)CC1.
What is the InChIKey of 2-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazole-4-carbaldehyde?
The InChIKey is NTURAGZYGBJKCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4S/c1-10(2-4-16(13,14)5-3-10)9-11-8(6-12)7-15-9/h6-7H,2-5H2,1H3.
What are the key properties of 2-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazole-4-carbaldehyde?
2-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazole-4-carbaldehyde has a molecular weight of 243.28 g/mol, XLogP of 0.95, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,1-dioxothian-4-yl)-1,3-oxazole-4-carbaldehyde is sourced from PubChem (CID 115044989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).