3-(2-methoxyphenyl)-2-oxopropane-1-sulfonyl fluoride

C10H11FO4S — CID 115045814

IUPAC3-(2-methoxyphenyl)-2-oxopropane-1-sulfonyl fluoride
SMILESCOc1ccccc1CC(=O)CS(=O)(=O)F
InChIInChI=1S/C10H11FO4S/c1-15-10-5-3-2-4-8(10)6-9(12)7-16(11,13)14/h2-5H,6-7H2,1H3
InChIKeyMGJAGCVMEQPYSF-UHFFFAOYSA-N
MW246.26 g/mol
LogP1.11
Rot. Bonds5

About 3-(2-methoxyphenyl)-2-oxopropane-1-sulfonyl fluoride

3-(2-methoxyphenyl)-2-oxopropane-1-sulfonyl fluoride (PubChem CID 115045814) has the molecular formula C10H11FO4S and a molecular weight of 246.26 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-2-oxopropane-1-sulfonyl fluoride.

Molecular Properties

Compound Name3-(2-methoxyphenyl)-2-oxopropane-1-sulfonyl fluoride
PubChem CID115045814
Molecular FormulaC10H11FO4S
Molecular Weight246.26 g/mol
Exact Mass246.04
IUPAC Name3-(2-methoxyphenyl)-2-oxopropane-1-sulfonyl fluoride
SMILESCOc1ccccc1CC(=O)CS(=O)(=O)F
InChIInChI=1S/C10H11FO4S/c1-15-10-5-3-2-4-8(10)6-9(12)7-16(11,13)14/h2-5H,6-7H2,1H3
InChIKeyMGJAGCVMEQPYSF-UHFFFAOYSA-N
XLogP1.11
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.26
LogP ≤ 51.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 3-(2-methoxyphenyl)-2-oxopropane-1-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-methoxyphenyl)-2-oxopropane-1-sulfonyl fluoride?
The IUPAC name of 3-(2-methoxyphenyl)-2-oxopropane-1-sulfonyl fluoride (CID 115045814) is 3-(2-methoxyphenyl)-2-oxopropane-1-sulfonyl fluoride.
What is the SMILES notation for 3-(2-methoxyphenyl)-2-oxopropane-1-sulfonyl fluoride?
The canonical SMILES for 3-(2-methoxyphenyl)-2-oxopropane-1-sulfonyl fluoride is COc1ccccc1CC(=O)CS(=O)(=O)F.
What is the InChIKey of 3-(2-methoxyphenyl)-2-oxopropane-1-sulfonyl fluoride?
The InChIKey is MGJAGCVMEQPYSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FO4S/c1-15-10-5-3-2-4-8(10)6-9(12)7-16(11,13)14/h2-5H,6-7H2,1H3.
What are the key properties of 3-(2-methoxyphenyl)-2-oxopropane-1-sulfonyl fluoride?
3-(2-methoxyphenyl)-2-oxopropane-1-sulfonyl fluoride has a molecular weight of 246.26 g/mol, XLogP of 1.11, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methoxyphenyl)-2-oxopropane-1-sulfonyl fluoride is sourced from PubChem (CID 115045814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).